C7H24O3Si4 — CID 123684084
[dimethyl(silyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane (PubChem CID 123684084) has the molecular formula C7H24O3Si4 and a molecular weight of 268.61 g/mol. Its IUPAC name is [dimethyl(silyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane.
| Compound Name | [dimethyl(silyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 123684084 |
| Molecular Formula | C7H24O3Si4 |
| Molecular Weight | 268.61 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | [dimethyl(silyloxy)silyl]oxy-dimethyl-trimethylsilyloxysilane |
| SMILES | C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[SiH3] |
| InChI | InChI=1S/C7H24O3Si4/c1-12(2,3)9-14(6,7)10-13(4,5)8-11/h1-7,11H3 |
| InChIKey | XWURDDJCDLBZCW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.61 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|