C11H30O3Si4 — CID 19995034
[dimethyl(trimethylsilyloxy)silyl]oxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 19995034) has the molecular formula C11H30O3Si4 and a molecular weight of 322.70 g/mol. Its IUPAC name is [dimethyl(trimethylsilyloxy)silyl]oxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 19995034 |
| Molecular Formula | C11H30O3Si4 |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [dimethyl(trimethylsilyloxy)silyl]oxy-[ethenyl(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C11H30O3Si4/c1-11-16(5,6)13-18(9,10)14-17(7,8)12-15(2,3)4/h11H,1H2,2-10H3 |
| InChIKey | UYUBMCBWYYZYJS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|