C13H34O3Si4 — CID 91194121
ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 91194121) has the molecular formula C13H34O3Si4 and a molecular weight of 350.76 g/mol. Its IUPAC name is ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane.
| Compound Name | ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 91194121 |
| Molecular Formula | C13H34O3Si4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C.C=C[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C7H18OSi2.C6H16O2Si2/c1-7-10(5,6)8-9(2,3)4;1-6-9(2,3)8-10(4,5)7/h7H,1H2,2-6H3;6-7H,1H2,2-5H3 |
| InChIKey | NPESNTNDFBYTCD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|