About ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane
ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane (PubChem CID 91194121) has the molecular formula C13H34O3Si4
and a molecular weight of 350.76 g/mol. Its IUPAC name is ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane.
Molecular Properties
| Compound Name | ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane |
| PubChem CID | 91194121 |
| Molecular Formula | C13H34O3Si4 |
| Molecular Weight | 350.76 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C.C=C[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C7H18OSi2.C6H16O2Si2/c1-7-10(5,6)8-9(2,3)4;1-6-9(2,3)8-10(4,5)7/h7H,1H2,2-6H3;6-7H,1H2,2-5H3 |
| InChIKey | NPESNTNDFBYTCD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.76 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane?
The IUPAC name of ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane (CID 91194121) is ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane.
What is the SMILES notation for ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane?
The canonical SMILES for ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane is C=C[Si](C)(C)O[Si](C)(C)C.C=C[Si](C)(C)O[Si](C)(C)O.
What is the InChIKey of ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane?
The InChIKey is NPESNTNDFBYTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18OSi2.C6H16O2Si2/c1-7-10(5,6)8-9(2,3)4;1-6-9(2,3)8-10(4,5)7/h7H,1H2,2-6H3;6-7H,1H2,2-5H3.
What are the key properties of ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane?
ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane has a molecular weight of 350.76 g/mol, XLogP of 4.40, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl-dimethyl-trimethylsilyloxysilane;ethenyl-[hydroxy(dimethyl)silyl]oxy-dimethylsilane is sourced from PubChem (CID 91194121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).