C9H28O7Si5 — CID 123355569
ethenyl-[(hydroxy-hydroxysilyl-trimethoxysilylsilyl)oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 123355569) has the molecular formula C9H28O7Si5 and a molecular weight of 388.75 g/mol. Its IUPAC name is ethenyl-[(hydroxy-hydroxysilyl-trimethoxysilylsilyl)oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | ethenyl-[(hydroxy-hydroxysilyl-trimethoxysilylsilyl)oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 123355569 |
| Molecular Formula | C9H28O7Si5 |
| Molecular Weight | 388.75 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | ethenyl-[(hydroxy-hydroxysilyl-trimethoxysilylsilyl)oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)O[Si](O)([SiH2]O)[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H28O7Si5/c1-9-18(5,6)15-19(7,8)16-20(11,17-10)21(12-2,13-3)14-4/h9-11H,1,17H2,2-8H3 |
| InChIKey | WWVMDRDHNVOBNB-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.75 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|