C18H48O6Si6 — CID 175748936
butoxy-[[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane (PubChem CID 175748936) has the molecular formula C18H48O6Si6 and a molecular weight of 529.09 g/mol. Its IUPAC name is butoxy-[[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane.
| Compound Name | butoxy-[[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 175748936 |
| Molecular Formula | C18H48O6Si6 |
| Molecular Weight | 529.09 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | butoxy-[[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)OCCCC |
| InChI | InChI=1S/C18H48O6Si6/c1-15-17-18-19-26(5,6)21-28(9,10)23-30(13,14)24-29(11,12)22-27(7,8)20-25(3,4)16-2/h16H,2,15,17-18H2,1,3-14H3 |
| InChIKey | IEAUTKFSPWMDFZ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.09 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|