C10H24O3Si3 — CID 86032993
bis[[ethenyl(dimethyl)silyl]oxy]-methoxy-methylsilane (PubChem CID 86032993) has the molecular formula C10H24O3Si3 and a molecular weight of 276.56 g/mol. Its IUPAC name is bis[[ethenyl(dimethyl)silyl]oxy]-methoxy-methylsilane.
| Compound Name | bis[[ethenyl(dimethyl)silyl]oxy]-methoxy-methylsilane |
|---|---|
| PubChem CID | 86032993 |
| Molecular Formula | C10H24O3Si3 |
| Molecular Weight | 276.56 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | bis[[ethenyl(dimethyl)silyl]oxy]-methoxy-methylsilane |
| SMILES | C=C[Si](C)(C)O[Si](C)(OC)O[Si](C)(C)C=C |
| InChI | InChI=1S/C10H24O3Si3/c1-9-14(4,5)12-16(8,11-3)13-15(6,7)10-2/h9-10H,1-2H2,3-8H3 |
| InChIKey | BLBYKRPCNOYPQF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.56 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|