C14H42O13Si6 — CID 174157171
[bis[[[dimethoxy(methyl)silyl]oxy-methoxy-methylsilyl]oxy]-methylsilyl]oxy-dimethoxy-methylsilane (PubChem CID 174157171) has the molecular formula C14H42O13Si6 and a molecular weight of 586.99 g/mol. Its IUPAC name is [bis[[[dimethoxy(methyl)silyl]oxy-methoxy-methylsilyl]oxy]-methylsilyl]oxy-dimethoxy-methylsilane.
| Compound Name | [bis[[[dimethoxy(methyl)silyl]oxy-methoxy-methylsilyl]oxy]-methylsilyl]oxy-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 174157171 |
| Molecular Formula | C14H42O13Si6 |
| Molecular Weight | 586.99 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | [bis[[[dimethoxy(methyl)silyl]oxy-methoxy-methylsilyl]oxy]-methylsilyl]oxy-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(OC)O[Si](C)(OC)O[Si](C)(O[Si](C)(OC)OC)O[Si](C)(OC)O[Si](C)(OC)OC |
| InChI | InChI=1S/C14H42O13Si6/c1-15-28(9,16-2)23-31(12,21-7)26-33(14,25-30(11,19-5)20-6)27-32(13,22-8)24-29(10,17-3)18-4/h1-14H3 |
| InChIKey | ZNUDWZDLCGHOMZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.99 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|