C4H14O5Si2 — CID 102353910
[dihydroxy(methyl)silyl]oxy-dimethoxy-methylsilane (PubChem CID 102353910) has the molecular formula C4H14O5Si2 and a molecular weight of 198.32 g/mol. Its IUPAC name is [dihydroxy(methyl)silyl]oxy-dimethoxy-methylsilane.
| Compound Name | [dihydroxy(methyl)silyl]oxy-dimethoxy-methylsilane |
|---|---|
| PubChem CID | 102353910 |
| Molecular Formula | C4H14O5Si2 |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | [dihydroxy(methyl)silyl]oxy-dimethoxy-methylsilane |
| SMILES | CO[Si](C)(OC)O[Si](C)(O)O |
| InChI | InChI=1S/C4H14O5Si2/c1-7-11(4,8-2)9-10(3,5)6/h5-6H,1-4H3 |
| InChIKey | NIDYTVLCLRTLCX-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|