C5H17BO6Si2 — CID 59973694
boranyl [dimethoxy(methyl)silyl] dimethyl silicate (PubChem CID 59973694) has the molecular formula C5H17BO6Si2 and a molecular weight of 240.17 g/mol. Its IUPAC name is boranyl [dimethoxy(methyl)silyl] dimethyl silicate.
| Compound Name | boranyl [dimethoxy(methyl)silyl] dimethyl silicate |
|---|---|
| PubChem CID | 59973694 |
| Molecular Formula | C5H17BO6Si2 |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | boranyl [dimethoxy(methyl)silyl] dimethyl silicate |
| SMILES | BO[Si](OC)(OC)O[Si](C)(OC)OC |
| InChI | InChI=1S/C5H17BO6Si2/c1-7-13(5,8-2)12-14(9-3,10-4)11-6/h6H2,1-5H3 |
| InChIKey | WDRSVLVUSJSVHA-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|