C6H18O7Si2Ti — CID 88632567
titanium;trimethyl trimethoxysilyl silicate (PubChem CID 88632567) has the molecular formula C6H18O7Si2Ti and a molecular weight of 306.24 g/mol. Its IUPAC name is titanium;trimethyl trimethoxysilyl silicate.
| Compound Name | titanium;trimethyl trimethoxysilyl silicate |
|---|---|
| PubChem CID | 88632567 |
| Molecular Formula | C6H18O7Si2Ti |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | titanium;trimethyl trimethoxysilyl silicate |
| SMILES | CO[Si](OC)(OC)O[Si](OC)(OC)OC.[Ti] |
| InChI | InChI=1S/C6H18O7Si2.Ti/c1-7-14(8-2,9-3)13-15(10-4,11-5)12-6;/h1-6H3; |
| InChIKey | OQTRXSIHRBTIGT-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|