C13H40O7Si6 — CID 123684059
dimethylsilyl [methoxy-bis(trimethylsilyloxy)silyl] methyl trimethylsilyl silicate (PubChem CID 123684059) has the molecular formula C13H40O7Si6 and a molecular weight of 476.97 g/mol. Its IUPAC name is dimethylsilyl [methoxy-bis(trimethylsilyloxy)silyl] methyl trimethylsilyl silicate.
| Compound Name | dimethylsilyl [methoxy-bis(trimethylsilyloxy)silyl] methyl trimethylsilyl silicate |
|---|---|
| PubChem CID | 123684059 |
| Molecular Formula | C13H40O7Si6 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | dimethylsilyl [methoxy-bis(trimethylsilyloxy)silyl] methyl trimethylsilyl silicate |
| SMILES | CO[Si](O[SiH](C)C)(O[Si](C)(C)C)O[Si](OC)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H40O7Si6/c1-14-25(16-21(3)4,17-22(5,6)7)20-26(15-2,18-23(8,9)10)19-24(11,12)13/h21H,1-13H3 |
| InChIKey | PEGIHSDRMNJILT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|