C15H40O2Si4 — CID 173480533
dimethylsilyloxy-[6-[dimethyl(trimethylsilyloxy)silyl]hexyl]-dimethylsilane (PubChem CID 173480533) has the molecular formula C15H40O2Si4 and a molecular weight of 364.83 g/mol. Its IUPAC name is dimethylsilyloxy-[6-[dimethyl(trimethylsilyloxy)silyl]hexyl]-dimethylsilane.
| Compound Name | dimethylsilyloxy-[6-[dimethyl(trimethylsilyloxy)silyl]hexyl]-dimethylsilane |
|---|---|
| PubChem CID | 173480533 |
| Molecular Formula | C15H40O2Si4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | dimethylsilyloxy-[6-[dimethyl(trimethylsilyloxy)silyl]hexyl]-dimethylsilane |
| SMILES | C[SiH](C)O[Si](C)(C)CCCCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H40O2Si4/c1-18(2)16-20(6,7)14-12-10-11-13-15-21(8,9)17-19(3,4)5/h18H,10-15H2,1-9H3 |
| InChIKey | BERCHUQMZAEPDN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|