C20H51BrO2Si4 — CID 161242476
4-bromobutyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;butyl-dimethylsilyloxy-dimethylsilane (PubChem CID 161242476) has the molecular formula C20H51BrO2Si4 and a molecular weight of 515.87 g/mol. Its IUPAC name is 4-bromobutyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;butyl-dimethylsilyloxy-dimethylsilane.
| Compound Name | 4-bromobutyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;butyl-dimethylsilyloxy-dimethylsilane |
|---|---|
| PubChem CID | 161242476 |
| Molecular Formula | C20H51BrO2Si4 |
| Molecular Weight | 515.87 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 4-bromobutyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;butyl-dimethylsilyloxy-dimethylsilane |
| SMILES | CCCC[Si](C)(C)O[SiH](C)C.CCCC[Si](C)(C)O[Si](C)(C)CCCCBr |
| InChI | InChI=1S/C12H29BrOSi2.C8H22OSi2/c1-6-7-11-15(2,3)14-16(4,5)12-9-8-10-13;1-6-7-8-11(4,5)9-10(2)3/h6-12H2,1-5H3;10H,6-8H2,1-5H3 |
| InChIKey | VAESQSMCLOBEHN-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.87 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|