About butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium
butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium (PubChem CID 158343933) has the molecular formula C12H30I2OSi2V
and a molecular weight of 551.30 g/mol. Its IUPAC name is butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium.
Molecular Properties
| Compound Name | butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium |
| PubChem CID | 158343933 |
| Molecular Formula | C12H30I2OSi2V |
| Molecular Weight | 551.30 g/mol |
| Exact Mass | 550.94 |
| IUPAC Name | butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCC.I[V]I |
| InChI | InChI=1S/C12H30OSi2.2HI.V/c1-7-9-11-14(3,4)13-15(5,6)12-10-8-2;;;/h7-12H2,1-6H3;2*1H;/q;;;+2/p-2 |
| InChIKey | GRMPLANRIUOYKI-UHFFFAOYSA-L |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 551.30 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium?
The IUPAC name of butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium (CID 158343933) is butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium.
What is the SMILES notation for butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium?
The canonical SMILES for butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium is CCCC[Si](C)(C)O[Si](C)(C)CCCC.I[V]I.
What is the InChIKey of butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium?
The InChIKey is GRMPLANRIUOYKI-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H30OSi2.2HI.V/c1-7-9-11-14(3,4)13-15(5,6)12-10-8-2;;;/h7-12H2,1-6H3;2*1H;/q;;;+2/p-2.
What are the key properties of butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium?
butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium has a molecular weight of 551.30 g/mol, XLogP of 6.78, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-[butyl(dimethyl)silyl]oxy-dimethylsilane;diiodovanadium is sourced from PubChem (CID 158343933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).