C25H60O4Si4 — CID 165155198
2,2-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]propane-1,3-diol (PubChem CID 165155198) has the molecular formula C25H60O4Si4 and a molecular weight of 537.10 g/mol. Its IUPAC name is 2,2-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]propane-1,3-diol.
| Compound Name | 2,2-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]propane-1,3-diol |
|---|---|
| PubChem CID | 165155198 |
| Molecular Formula | C25H60O4Si4 |
| Molecular Weight | 537.10 g/mol |
| Exact Mass | 536.36 |
| IUPAC Name | 2,2-bis[3-[[butyl(dimethyl)silyl]oxy-dimethylsilyl]propyl]propane-1,3-diol |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)CCCC(CO)(CO)CCC[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C25H60O4Si4/c1-11-13-19-30(3,4)28-32(7,8)21-15-17-25(23-26,24-27)18-16-22-33(9,10)29-31(5,6)20-14-12-2/h26-27H,11-24H2,1-10H3 |
| InChIKey | NHNWTLBKXQMMBL-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.10 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|