C8H21LiO2Si2 — CID 140620084
lithium butyl-[dimethyl(oxido)silyl]oxy-dimethylsilane (PubChem CID 140620084) has the molecular formula C8H21LiO2Si2 and a molecular weight of 212.37 g/mol. Its IUPAC name is lithium butyl-[dimethyl(oxido)silyl]oxy-dimethylsilane.
| Compound Name | lithium butyl-[dimethyl(oxido)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 140620084 |
| Molecular Formula | C8H21LiO2Si2 |
| Molecular Weight | 212.37 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | lithium butyl-[dimethyl(oxido)silyl]oxy-dimethylsilane |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)[O-].[Li+] |
| InChI | InChI=1S/C8H21O2Si2.Li/c1-6-7-8-11(2,3)10-12(4,5)9;/h6-8H2,1-5H3;/q-1;+1 |
| InChIKey | VLGOTEBEDOTZSY-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.37 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|