C14H26OSi2 — CID 167313973
butyl-[dimethyl(phenyl)silyl]oxy-dimethylsilane (PubChem CID 167313973) has the molecular formula C14H26OSi2 and a molecular weight of 266.53 g/mol. Its IUPAC name is butyl-[dimethyl(phenyl)silyl]oxy-dimethylsilane.
| Compound Name | butyl-[dimethyl(phenyl)silyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 167313973 |
| Molecular Formula | C14H26OSi2 |
| Molecular Weight | 266.53 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | butyl-[dimethyl(phenyl)silyl]oxy-dimethylsilane |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H26OSi2/c1-6-7-13-16(2,3)15-17(4,5)14-11-9-8-10-12-14/h8-12H,6-7,13H2,1-5H3 |
| InChIKey | FBNLCFMSUHQWMA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|