C18H39BO5Si4 — CID 153321821
[2-[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]boronic acid (PubChem CID 153321821) has the molecular formula C18H39BO5Si4 and a molecular weight of 458.66 g/mol. Its IUPAC name is [2-[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]boronic acid.
| Compound Name | [2-[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 153321821 |
| Molecular Formula | C18H39BO5Si4 |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | [2-[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]boronic acid |
| SMILES | CCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)c1ccccc1B(O)O |
| InChI | InChI=1S/C18H39BO5Si4/c1-10-11-16-25(2,3)22-27(6,7)24-28(8,9)23-26(4,5)18-15-13-12-14-17(18)19(20)21/h12-15,20-21H,10-11,16H2,1-9H3 |
| InChIKey | CZLTZRDGQPGALI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|