C27H45NO3Si4 — CID 139630672
4-[4-[[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile (PubChem CID 139630672) has the molecular formula C27H45NO3Si4 and a molecular weight of 544.01 g/mol. Its IUPAC name is 4-[4-[[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139630672 |
| Molecular Formula | C27H45NO3Si4 |
| Molecular Weight | 544.01 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 4-[4-[[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile |
| SMILES | CCCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C27H45NO3Si4/c1-10-11-12-13-22-32(2,3)29-34(6,7)31-35(8,9)30-33(4,5)27-20-18-26(19-21-27)25-16-14-24(23-28)15-17-25/h14-21H,10-13,22H2,1-9H3 |
| InChIKey | LDXMHHJOAHGVJH-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.01 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|