C23H33NOSi2 — CID 139630608
4-[4-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]methyl]phenyl]benzonitrile (PubChem CID 139630608) has the molecular formula C23H33NOSi2 and a molecular weight of 395.70 g/mol. Its IUPAC name is 4-[4-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]methyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]methyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139630608 |
| Molecular Formula | C23H33NOSi2 |
| Molecular Weight | 395.70 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 4-[4-[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]methyl]phenyl]benzonitrile |
| SMILES | CCCCC[Si](C)(C)O[Si](C)(C)Cc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C23H33NOSi2/c1-6-7-8-17-26(2,3)25-27(4,5)19-21-11-15-23(16-12-21)22-13-9-20(18-24)10-14-22/h9-16H,6-8,17,19H2,1-5H3 |
| InChIKey | JCJCWGFQBCQCRX-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.70 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|