C26H37NO2Si2 — CID 101341578
4-[4-[5-[[but-3-enyl(dimethyl)silyl]oxy-dimethylsilyl]pentoxy]phenyl]benzonitrile (PubChem CID 101341578) has the molecular formula C26H37NO2Si2 and a molecular weight of 451.76 g/mol. Its IUPAC name is 4-[4-[5-[[but-3-enyl(dimethyl)silyl]oxy-dimethylsilyl]pentoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[5-[[but-3-enyl(dimethyl)silyl]oxy-dimethylsilyl]pentoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 101341578 |
| Molecular Formula | C26H37NO2Si2 |
| Molecular Weight | 451.76 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 4-[4-[5-[[but-3-enyl(dimethyl)silyl]oxy-dimethylsilyl]pentoxy]phenyl]benzonitrile |
| SMILES | C=CCC[Si](C)(C)O[Si](C)(C)CCCCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C26H37NO2Si2/c1-6-7-20-30(2,3)29-31(4,5)21-10-8-9-19-28-26-17-15-25(16-18-26)24-13-11-23(22-27)12-14-24/h6,11-18H,1,7-10,19-21H2,2-5H3 |
| InChIKey | RNIKBTMLGAXFSH-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.76 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|