C24H35NO2Si2 — CID 139630778
4-[4-[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]methoxy]phenyl]benzonitrile (PubChem CID 139630778) has the molecular formula C24H35NO2Si2 and a molecular weight of 425.72 g/mol. Its IUPAC name is 4-[4-[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]methoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]methoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139630778 |
| Molecular Formula | C24H35NO2Si2 |
| Molecular Weight | 425.72 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 4-[4-[[[hexyl(dimethyl)silyl]oxy-dimethylsilyl]methoxy]phenyl]benzonitrile |
| SMILES | CCCCCC[Si](C)(C)O[Si](C)(C)COc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C24H35NO2Si2/c1-6-7-8-9-18-28(2,3)27-29(4,5)20-26-24-16-14-23(15-17-24)22-12-10-21(19-25)11-13-22/h10-17H,6-9,18,20H2,1-5H3 |
| InChIKey | VUXSIYDGYCJRHP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.72 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|