C28H43NOSi2 — CID 102198253
4-[4-[10-[dimethyl(trimethylsilyl)silyl]decoxy]phenyl]benzonitrile (PubChem CID 102198253) has the molecular formula C28H43NOSi2 and a molecular weight of 465.83 g/mol. Its IUPAC name is 4-[4-[10-[dimethyl(trimethylsilyl)silyl]decoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[10-[dimethyl(trimethylsilyl)silyl]decoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 102198253 |
| Molecular Formula | C28H43NOSi2 |
| Molecular Weight | 465.83 g/mol |
| Exact Mass | 465.29 |
| IUPAC Name | 4-[4-[10-[dimethyl(trimethylsilyl)silyl]decoxy]phenyl]benzonitrile |
| SMILES | C[Si](C)(C)[Si](C)(C)CCCCCCCCCCOc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C28H43NOSi2/c1-31(2,3)32(4,5)23-13-11-9-7-6-8-10-12-22-30-28-20-18-27(19-21-28)26-16-14-25(24-29)15-17-26/h14-21H,6-13,22-23H2,1-5H3 |
| InChIKey | LHCSNDSZZUPMAT-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.83 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|