C25H20F5NO2 — CID 86004959
4-[4-[6-(2,3,4,5,6-pentafluorophenoxy)hexoxy]phenyl]benzonitrile (PubChem CID 86004959) has the molecular formula C25H20F5NO2 and a molecular weight of 461.43 g/mol. Its IUPAC name is 4-[4-[6-(2,3,4,5,6-pentafluorophenoxy)hexoxy]phenyl]benzonitrile.
| Compound Name | 4-[4-[6-(2,3,4,5,6-pentafluorophenoxy)hexoxy]phenyl]benzonitrile |
|---|---|
| PubChem CID | 86004959 |
| Molecular Formula | C25H20F5NO2 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 4-[4-[6-(2,3,4,5,6-pentafluorophenoxy)hexoxy]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(OCCCCCCOc3c(F)c(F)c(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C25H20F5NO2/c26-20-21(27)23(29)25(24(30)22(20)28)33-14-4-2-1-3-13-32-19-11-9-18(10-12-19)17-7-5-16(15-31)6-8-17/h5-12H,1-4,13-14H2 |
| InChIKey | YPKCPVOCMQUEAP-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|