C27H23F4NO3 — CID 101203179
(4-cyanophenyl) 4-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)benzoate (PubChem CID 101203179) has the molecular formula C27H23F4NO3 and a molecular weight of 485.48 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)benzoate.
| Compound Name | (4-cyanophenyl) 4-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101203179 |
| Molecular Formula | C27H23F4NO3 |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | (4-cyanophenyl) 4-(2,3,5,6-tetrafluoro-4-heptoxyphenyl)benzoate |
| SMILES | CCCCCCCOc1c(F)c(F)c(-c2ccc(C(=O)Oc3ccc(C#N)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C27H23F4NO3/c1-2-3-4-5-6-15-34-26-24(30)22(28)21(23(29)25(26)31)18-9-11-19(12-10-18)27(33)35-20-13-7-17(16-32)8-14-20/h7-14H,2-6,15H2,1H3 |
| InChIKey | GKMNOFXKLFCJBP-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|