C30H32F4O4 — CID 101206938
(4-methoxyphenyl) 4-(4-decoxy-2,3,5,6-tetrafluorophenyl)benzoate (PubChem CID 101206938) has the molecular formula C30H32F4O4 and a molecular weight of 532.57 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-(4-decoxy-2,3,5,6-tetrafluorophenyl)benzoate.
| Compound Name | (4-methoxyphenyl) 4-(4-decoxy-2,3,5,6-tetrafluorophenyl)benzoate |
|---|---|
| PubChem CID | 101206938 |
| Molecular Formula | C30H32F4O4 |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (4-methoxyphenyl) 4-(4-decoxy-2,3,5,6-tetrafluorophenyl)benzoate |
| SMILES | CCCCCCCCCCOc1c(F)c(F)c(-c2ccc(C(=O)Oc3ccc(OC)cc3)cc2)c(F)c1F |
| InChI | InChI=1S/C30H32F4O4/c1-3-4-5-6-7-8-9-10-19-37-29-27(33)25(31)24(26(32)28(29)34)20-11-13-21(14-12-20)30(35)38-23-17-15-22(36-2)16-18-23/h11-18H,3-10,19H2,1-2H3 |
| InChIKey | MWTUNUYBKDDOJC-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|