About (4-methoxyphenyl) 4-pentoxybenzoate
(4-methoxyphenyl) 4-pentoxybenzoate (PubChem CID 23011479) has the molecular formula C19H22O4
and a molecular weight of 314.38 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-pentoxybenzoate.
Molecular Properties
| Compound Name | (4-methoxyphenyl) 4-pentoxybenzoate |
| PubChem CID | 23011479 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (4-methoxyphenyl) 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H22O4/c1-3-4-5-14-22-17-8-6-15(7-9-17)19(20)23-18-12-10-16(21-2)11-13-18/h6-13H,3-5,14H2,1-2H3 |
| InChIKey | ZMMOBYFQFILZLB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl) 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl) 4-pentoxybenzoate?
The IUPAC name of (4-methoxyphenyl) 4-pentoxybenzoate (CID 23011479) is (4-methoxyphenyl) 4-pentoxybenzoate.
What is the SMILES notation for (4-methoxyphenyl) 4-pentoxybenzoate?
The canonical SMILES for (4-methoxyphenyl) 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)Oc2ccc(OC)cc2)cc1.
What is the InChIKey of (4-methoxyphenyl) 4-pentoxybenzoate?
The InChIKey is ZMMOBYFQFILZLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22O4/c1-3-4-5-14-22-17-8-6-15(7-9-17)19(20)23-18-12-10-16(21-2)11-13-18/h6-13H,3-5,14H2,1-2H3.
What are the key properties of (4-methoxyphenyl) 4-pentoxybenzoate?
(4-methoxyphenyl) 4-pentoxybenzoate has a molecular weight of 314.38 g/mol, XLogP of 4.48, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl) 4-pentoxybenzoate is sourced from PubChem (CID 23011479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).