About [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate
[4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate (PubChem CID 21133479) has the molecular formula C30H34O5
and a molecular weight of 474.60 g/mol. Its IUPAC name is [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate.
Molecular Properties
| Compound Name | [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate |
| PubChem CID | 21133479 |
| Molecular Formula | C30H34O5 |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate |
| SMILES | CCCCCOc1ccc(C(=O)Oc2ccc(C(=O)c3ccc(OCCCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H34O5/c1-3-5-7-21-33-26-15-9-23(10-16-26)29(31)24-11-19-28(20-12-24)35-30(32)25-13-17-27(18-14-25)34-22-8-6-4-2/h9-20H,3-8,21-22H2,1-2H3 |
| InChIKey | UNQWVKBGBXVDAV-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate?
The IUPAC name of [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate (CID 21133479) is [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate.
What is the SMILES notation for [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate?
The canonical SMILES for [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate is CCCCCOc1ccc(C(=O)Oc2ccc(C(=O)c3ccc(OCCCCC)cc3)cc2)cc1.
What is the InChIKey of [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate?
The InChIKey is UNQWVKBGBXVDAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H34O5/c1-3-5-7-21-33-26-15-9-23(10-16-26)29(31)24-11-19-28(20-12-24)35-30(32)25-13-17-27(18-14-25)34-22-8-6-4-2/h9-20H,3-8,21-22H2,1-2H3.
What are the key properties of [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate?
[4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate has a molecular weight of 474.60 g/mol, XLogP of 7.27, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-pentoxybenzoyl)phenyl] 4-pentoxybenzoate is sourced from PubChem (CID 21133479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).