C26H43NO3Si4 — CID 139630716
4-[4-[[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile (PubChem CID 139630716) has the molecular formula C26H43NO3Si4 and a molecular weight of 529.98 g/mol. Its IUPAC name is 4-[4-[[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 139630716 |
| Molecular Formula | C26H43NO3Si4 |
| Molecular Weight | 529.98 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 4-[4-[[[[dimethyl(pentyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]phenyl]benzonitrile |
| SMILES | CCCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)c1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C26H43NO3Si4/c1-10-11-12-21-31(2,3)28-33(6,7)30-34(8,9)29-32(4,5)26-19-17-25(18-20-26)24-15-13-23(22-27)14-16-24/h13-20H,10-12,21H2,1-9H3 |
| InChIKey | SIFGXZCWDQHGSG-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.98 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|