C19H28O2Si2 — CID 59202642
2-[3-[[dimethyl(phenyl)silyl]oxy-dimethylsilyl]propyl]phenol (PubChem CID 59202642) has the molecular formula C19H28O2Si2 and a molecular weight of 344.60 g/mol. Its IUPAC name is 2-[3-[[dimethyl(phenyl)silyl]oxy-dimethylsilyl]propyl]phenol.
| Compound Name | 2-[3-[[dimethyl(phenyl)silyl]oxy-dimethylsilyl]propyl]phenol |
|---|---|
| PubChem CID | 59202642 |
| Molecular Formula | C19H28O2Si2 |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2-[3-[[dimethyl(phenyl)silyl]oxy-dimethylsilyl]propyl]phenol |
| SMILES | C[Si](C)(CCCc1ccccc1O)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H28O2Si2/c1-22(2,16-10-12-17-11-8-9-15-19(17)20)21-23(3,4)18-13-6-5-7-14-18/h5-9,11,13-15,20H,10,12,16H2,1-4H3 |
| InChIKey | ROHUFTZKPUQJMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|