C34H38O2Si3 — CID 174793025
[dimethyl(phenyl)silyl]oxy-dimethyl-phenylsilane;hydroxy(triphenyl)silane (PubChem CID 174793025) has the molecular formula C34H38O2Si3 and a molecular weight of 562.93 g/mol. Its IUPAC name is [dimethyl(phenyl)silyl]oxy-dimethyl-phenylsilane;hydroxy(triphenyl)silane.
| Compound Name | [dimethyl(phenyl)silyl]oxy-dimethyl-phenylsilane;hydroxy(triphenyl)silane |
|---|---|
| PubChem CID | 174793025 |
| Molecular Formula | C34H38O2Si3 |
| Molecular Weight | 562.93 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | [dimethyl(phenyl)silyl]oxy-dimethyl-phenylsilane;hydroxy(triphenyl)silane |
| SMILES | C[Si](C)(O[Si](C)(C)c1ccccc1)c1ccccc1.O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H16OSi.C16H22OSi2/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16/h1-15,19H;5-14H,1-4H3 |
| InChIKey | RYSRSBXIYHFXSQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.93 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|