C52H53ClO2Si4 — CID 158640447
chloro-dimethyl-phenylsilane;dimethyl-phenyl-triphenylsilyloxysilane;hydroxy(triphenyl)silane (PubChem CID 158640447) has the molecular formula C52H53ClO2Si4 and a molecular weight of 857.79 g/mol. Its IUPAC name is chloro-dimethyl-phenylsilane;dimethyl-phenyl-triphenylsilyloxysilane;hydroxy(triphenyl)silane.
| Compound Name | chloro-dimethyl-phenylsilane;dimethyl-phenyl-triphenylsilyloxysilane;hydroxy(triphenyl)silane |
|---|---|
| PubChem CID | 158640447 |
| Molecular Formula | C52H53ClO2Si4 |
| Molecular Weight | 857.79 g/mol |
| Exact Mass | 856.28 |
| IUPAC Name | chloro-dimethyl-phenylsilane;dimethyl-phenyl-triphenylsilyloxysilane;hydroxy(triphenyl)silane |
| SMILES | C[Si](C)(Cl)c1ccccc1.C[Si](C)(O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1.O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H26OSi2.C18H16OSi.C8H11ClSi/c1-28(2,23-15-7-3-8-16-23)27-29(24-17-9-4-10-18-24,25-19-11-5-12-20-25)26-21-13-6-14-22-26;19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-10(2,9)8-6-4-3-5-7-8/h3-22H,1-2H3;1-15,19H;3-7H,1-2H3 |
| InChIKey | IAHSWKNYMULNCX-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.79 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|