C54H46O4Si4 — CID 18323248
[diphenyl(triphenylsilyloxy)silyl]oxy-[hydroxy(diphenyl)silyl]oxy-diphenylsilane (PubChem CID 18323248) has the molecular formula C54H46O4Si4 and a molecular weight of 871.30 g/mol. Its IUPAC name is [diphenyl(triphenylsilyloxy)silyl]oxy-[hydroxy(diphenyl)silyl]oxy-diphenylsilane.
| Compound Name | [diphenyl(triphenylsilyloxy)silyl]oxy-[hydroxy(diphenyl)silyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 18323248 |
| Molecular Formula | C54H46O4Si4 |
| Molecular Weight | 871.30 g/mol |
| Exact Mass | 870.25 |
| IUPAC Name | [diphenyl(triphenylsilyloxy)silyl]oxy-[hydroxy(diphenyl)silyl]oxy-diphenylsilane |
| SMILES | O[Si](O[Si](O[Si](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C54H46O4Si4/c55-60(49-34-16-4-17-35-49,50-36-18-5-19-37-50)57-62(53-42-24-8-25-43-53,54-44-26-9-27-45-54)58-61(51-38-20-6-21-39-51,52-40-22-7-23-41-52)56-59(46-28-10-1-11-29-46,47-30-12-2-13-31-47)48-32-14-3-15-33-48/h1-45,55H |
| InChIKey | XBOGUHJMXURICT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|