C36H43O4Si5 — CID 90340316
CID 90340316 (PubChem CID 90340316) has the molecular formula C36H43O4Si5 and a molecular weight of 680.17 g/mol.
| Compound Name | CID 90340316 |
|---|---|
| PubChem CID | 90340316 |
| Molecular Formula | C36H43O4Si5 |
| Molecular Weight | 680.17 g/mol |
| Exact Mass | 679.20 |
| IUPAC Name | — |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)(C)O[Si](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H43O4Si5/c1-41(2)37-42(3,4)38-43(5,6)39-45(35-28-18-10-19-29-35,36-30-20-11-21-31-36)40-44(32-22-12-7-13-23-32,33-24-14-8-15-25-33)34-26-16-9-17-27-34/h7-31H,1-6H3 |
| InChIKey | DKRVMEFRNCPGEK-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.17 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|