C38H36O2Si3 — CID 19905828
bis[[methyl(diphenyl)silyl]oxy]-diphenylsilane (PubChem CID 19905828) has the molecular formula C38H36O2Si3 and a molecular weight of 608.96 g/mol. Its IUPAC name is bis[[methyl(diphenyl)silyl]oxy]-diphenylsilane.
| Compound Name | bis[[methyl(diphenyl)silyl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 19905828 |
| Molecular Formula | C38H36O2Si3 |
| Molecular Weight | 608.96 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | bis[[methyl(diphenyl)silyl]oxy]-diphenylsilane |
| SMILES | C[Si](O[Si](O[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H36O2Si3/c1-41(33-21-9-3-10-22-33,34-23-11-4-12-24-34)39-43(37-29-17-7-18-30-37,38-31-19-8-20-32-38)40-42(2,35-25-13-5-14-26-35)36-27-15-6-16-28-36/h3-32H,1-2H3 |
| InChIKey | LYJRJQPPJDXSBG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.96 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|