C18H30O3Si4 — CID 173332596
[dimethyl-[methyl(diphenyl)silyl]oxysilyl]oxy-dimethyl-methylsilyloxysilane (PubChem CID 173332596) has the molecular formula C18H30O3Si4 and a molecular weight of 406.78 g/mol. Its IUPAC name is [dimethyl-[methyl(diphenyl)silyl]oxysilyl]oxy-dimethyl-methylsilyloxysilane.
| Compound Name | [dimethyl-[methyl(diphenyl)silyl]oxysilyl]oxy-dimethyl-methylsilyloxysilane |
|---|---|
| PubChem CID | 173332596 |
| Molecular Formula | C18H30O3Si4 |
| Molecular Weight | 406.78 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | [dimethyl-[methyl(diphenyl)silyl]oxysilyl]oxy-dimethyl-methylsilyloxysilane |
| SMILES | C[SiH2]O[Si](C)(C)O[Si](C)(C)O[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H30O3Si4/c1-22-19-23(2,3)20-24(4,5)21-25(6,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,22H2,1-6H3 |
| InChIKey | RDAOJXRRBZLGAP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.78 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|