C28H32O4Si3 — CID 140743013
dimethoxy-methyl-[[methyl(diphenyl)silyl]oxy-diphenylsilyl]oxysilane (PubChem CID 140743013) has the molecular formula C28H32O4Si3 and a molecular weight of 516.82 g/mol. Its IUPAC name is dimethoxy-methyl-[[methyl(diphenyl)silyl]oxy-diphenylsilyl]oxysilane.
| Compound Name | dimethoxy-methyl-[[methyl(diphenyl)silyl]oxy-diphenylsilyl]oxysilane |
|---|---|
| PubChem CID | 140743013 |
| Molecular Formula | C28H32O4Si3 |
| Molecular Weight | 516.82 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | dimethoxy-methyl-[[methyl(diphenyl)silyl]oxy-diphenylsilyl]oxysilane |
| SMILES | CO[Si](C)(OC)O[Si](O[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H32O4Si3/c1-29-34(4,30-2)32-35(27-21-13-7-14-22-27,28-23-15-8-16-24-28)31-33(3,25-17-9-5-10-18-25)26-19-11-6-12-20-26/h5-24H,1-4H3 |
| InChIKey | ABTCYBDOQKNLFK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|