About trimethoxy(phenyl)silane;hydrochloride
trimethoxy(phenyl)silane;hydrochloride (PubChem CID 140901295) has the molecular formula C9H15ClO3Si
and a molecular weight of 234.75 g/mol. Its IUPAC name is trimethoxy(phenyl)silane;hydrochloride.
Molecular Properties
| Compound Name | trimethoxy(phenyl)silane;hydrochloride |
| PubChem CID | 140901295 |
| Molecular Formula | C9H15ClO3Si |
| Molecular Weight | 234.75 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | trimethoxy(phenyl)silane;hydrochloride |
| SMILES | CO[Si](OC)(OC)c1ccccc1.Cl |
| InChI | InChI=1S/C9H14O3Si.ClH/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H |
| InChIKey | RIGNJGOIMWMTRV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.75 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(phenyl)silane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(phenyl)silane;hydrochloride?
The IUPAC name of trimethoxy(phenyl)silane;hydrochloride (CID 140901295) is trimethoxy(phenyl)silane;hydrochloride.
What is the SMILES notation for trimethoxy(phenyl)silane;hydrochloride?
The canonical SMILES for trimethoxy(phenyl)silane;hydrochloride is CO[Si](OC)(OC)c1ccccc1.Cl.
What is the InChIKey of trimethoxy(phenyl)silane;hydrochloride?
The InChIKey is RIGNJGOIMWMTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3Si.ClH/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H.
What are the key properties of trimethoxy(phenyl)silane;hydrochloride?
trimethoxy(phenyl)silane;hydrochloride has a molecular weight of 234.75 g/mol, XLogP of 1.19, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(phenyl)silane;hydrochloride is sourced from PubChem (CID 140901295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).