About phenylmethoxysilane;trimethoxy(phenyl)silane
phenylmethoxysilane;trimethoxy(phenyl)silane (PubChem CID 173314465) has the molecular formula C16H24O4Si2
and a molecular weight of 336.54 g/mol. Its IUPAC name is phenylmethoxysilane;trimethoxy(phenyl)silane.
Molecular Properties
| Compound Name | phenylmethoxysilane;trimethoxy(phenyl)silane |
| PubChem CID | 173314465 |
| Molecular Formula | C16H24O4Si2 |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | phenylmethoxysilane;trimethoxy(phenyl)silane |
| SMILES | CO[Si](OC)(OC)c1ccccc1.[SiH3]OCc1ccccc1 |
| InChI | InChI=1S/C9H14O3Si.C7H10OSi/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;9-8-6-7-4-2-1-3-5-7/h4-8H,1-3H3;1-5H,6H2,9H3 |
| InChIKey | BPFCENIBIWDWKK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze phenylmethoxysilane;trimethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethoxysilane;trimethoxy(phenyl)silane?
The IUPAC name of phenylmethoxysilane;trimethoxy(phenyl)silane (CID 173314465) is phenylmethoxysilane;trimethoxy(phenyl)silane.
What is the SMILES notation for phenylmethoxysilane;trimethoxy(phenyl)silane?
The canonical SMILES for phenylmethoxysilane;trimethoxy(phenyl)silane is CO[Si](OC)(OC)c1ccccc1.[SiH3]OCc1ccccc1.
What is the InChIKey of phenylmethoxysilane;trimethoxy(phenyl)silane?
The InChIKey is BPFCENIBIWDWKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3Si.C7H10OSi/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;9-8-6-7-4-2-1-3-5-7/h4-8H,1-3H3;1-5H,6H2,9H3.
What are the key properties of phenylmethoxysilane;trimethoxy(phenyl)silane?
phenylmethoxysilane;trimethoxy(phenyl)silane has a molecular weight of 336.54 g/mol, XLogP of 1.26, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxysilane;trimethoxy(phenyl)silane is sourced from PubChem (CID 173314465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).