About dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane
dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane (PubChem CID 160738945) has the molecular formula C24H34O6Si2
and a molecular weight of 474.70 g/mol. Its IUPAC name is dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane.
Molecular Properties
| Compound Name | dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane |
| PubChem CID | 160738945 |
| Molecular Formula | C24H34O6Si2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane |
| SMILES | CO.CO[Si](OC)(OC)c1ccccc1.CO[Si](OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16O2Si.C9H14O3Si.CH4O/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-2/h3-12H,1-2H3;4-8H,1-3H3;2H,1H3 |
| InChIKey | RVHXCFKEGYLMJW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane?
The IUPAC name of dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane (CID 160738945) is dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane.
What is the SMILES notation for dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane?
The canonical SMILES for dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane is CO.CO[Si](OC)(OC)c1ccccc1.CO[Si](OC)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane?
The InChIKey is RVHXCFKEGYLMJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2Si.C9H14O3Si.CH4O/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-2/h3-12H,1-2H3;4-8H,1-3H3;2H,1H3.
What are the key properties of dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane?
dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane has a molecular weight of 474.70 g/mol, XLogP of 1.92, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(diphenyl)silane;methanol;trimethoxy(phenyl)silane is sourced from PubChem (CID 160738945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).