C62H56O6Si5 — CID 140689464
[diphenyl(triphenylsilyloxy)silyl]oxy-methoxy-[[methoxy(diphenyl)silyl]oxy-diphenylsilyl]oxy-phenylsilane (PubChem CID 140689464) has the molecular formula C62H56O6Si5 and a molecular weight of 1037.55 g/mol. Its IUPAC name is [diphenyl(triphenylsilyloxy)silyl]oxy-methoxy-[[methoxy(diphenyl)silyl]oxy-diphenylsilyl]oxy-phenylsilane.
| Compound Name | [diphenyl(triphenylsilyloxy)silyl]oxy-methoxy-[[methoxy(diphenyl)silyl]oxy-diphenylsilyl]oxy-phenylsilane |
|---|---|
| PubChem CID | 140689464 |
| Molecular Formula | C62H56O6Si5 |
| Molecular Weight | 1037.55 g/mol |
| Exact Mass | 1036.29 |
| IUPAC Name | [diphenyl(triphenylsilyloxy)silyl]oxy-methoxy-[[methoxy(diphenyl)silyl]oxy-diphenylsilyl]oxy-phenylsilane |
| SMILES | CO[Si](O[Si](O[Si](OC)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(O[Si](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C62H56O6Si5/c1-63-70(56-39-19-6-20-40-56,57-41-21-7-22-42-57)66-72(60-47-27-10-28-48-60,61-49-29-11-30-50-61)68-73(64-2,62-51-31-12-32-52-62)67-71(58-43-23-8-24-44-58,59-45-25-9-26-46-59)65-69(53-33-13-3-14-34-53,54-35-15-4-16-36-54)55-37-17-5-18-38-55/h3-52H,1-2H3 |
| InChIKey | NIZQHQGNIOAAAW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1037.55 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|