C43H48O7Si4 — CID 87832768
tris[4-[dimethoxy(phenyl)silyl]phenyl]-methoxysilane (PubChem CID 87832768) has the molecular formula C43H48O7Si4 and a molecular weight of 789.19 g/mol. Its IUPAC name is tris[4-[dimethoxy(phenyl)silyl]phenyl]-methoxysilane.
| Compound Name | tris[4-[dimethoxy(phenyl)silyl]phenyl]-methoxysilane |
|---|---|
| PubChem CID | 87832768 |
| Molecular Formula | C43H48O7Si4 |
| Molecular Weight | 789.19 g/mol |
| Exact Mass | 788.25 |
| IUPAC Name | tris[4-[dimethoxy(phenyl)silyl]phenyl]-methoxysilane |
| SMILES | CO[Si](OC)(c1ccccc1)c1ccc([Si](OC)(c2ccc([Si](OC)(OC)c3ccccc3)cc2)c2ccc([Si](OC)(OC)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C43H48O7Si4/c1-44-51(35-23-29-41(30-24-35)52(45-2,46-3)38-17-11-8-12-18-38,36-25-31-42(32-26-36)53(47-4,48-5)39-19-13-9-14-20-39)37-27-33-43(34-28-37)54(49-6,50-7)40-21-15-10-16-22-40/h8-34H,1-7H3 |
| InChIKey | MEFTYZHLLJAOTR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|