C38H36O4Si3 — CID 54456197
bis[[methoxy(diphenyl)silyl]oxy]-diphenylsilane (PubChem CID 54456197) has the molecular formula C38H36O4Si3 and a molecular weight of 640.96 g/mol. Its IUPAC name is bis[[methoxy(diphenyl)silyl]oxy]-diphenylsilane.
| Compound Name | bis[[methoxy(diphenyl)silyl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 54456197 |
| Molecular Formula | C38H36O4Si3 |
| Molecular Weight | 640.96 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | bis[[methoxy(diphenyl)silyl]oxy]-diphenylsilane |
| SMILES | CO[Si](O[Si](O[Si](OC)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H36O4Si3/c1-39-43(33-21-9-3-10-22-33,34-23-11-4-12-24-34)41-45(37-29-17-7-18-30-37,38-31-19-8-20-32-38)42-44(40-2,35-25-13-5-14-26-35)36-27-15-6-16-28-36/h3-32H,1-2H3 |
| InChIKey | WYIYNOWCFOYUFS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|