About dimethoxy(diphenyl)silane;triethoxy(phenyl)silane
dimethoxy(diphenyl)silane;triethoxy(phenyl)silane (PubChem CID 174286071) has the molecular formula C26H36O5Si2
and a molecular weight of 484.74 g/mol. Its IUPAC name is dimethoxy(diphenyl)silane;triethoxy(phenyl)silane.
Molecular Properties
| Compound Name | dimethoxy(diphenyl)silane;triethoxy(phenyl)silane |
| PubChem CID | 174286071 |
| Molecular Formula | C26H36O5Si2 |
| Molecular Weight | 484.74 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | dimethoxy(diphenyl)silane;triethoxy(phenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1.CO[Si](OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H16O2Si.C12H20O3Si/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h3-12H,1-2H3;7-11H,4-6H2,1-3H3 |
| InChIKey | HRLJALXMBRFJSO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(diphenyl)silane;triethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(diphenyl)silane;triethoxy(phenyl)silane?
The IUPAC name of dimethoxy(diphenyl)silane;triethoxy(phenyl)silane (CID 174286071) is dimethoxy(diphenyl)silane;triethoxy(phenyl)silane.
What is the SMILES notation for dimethoxy(diphenyl)silane;triethoxy(phenyl)silane?
The canonical SMILES for dimethoxy(diphenyl)silane;triethoxy(phenyl)silane is CCO[Si](OCC)(OCC)c1ccccc1.CO[Si](OC)(c1ccccc1)c1ccccc1.
What is the InChIKey of dimethoxy(diphenyl)silane;triethoxy(phenyl)silane?
The InChIKey is HRLJALXMBRFJSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O2Si.C12H20O3Si/c1-15-17(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14;1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h3-12H,1-2H3;7-11H,4-6H2,1-3H3.
What are the key properties of dimethoxy(diphenyl)silane;triethoxy(phenyl)silane?
dimethoxy(diphenyl)silane;triethoxy(phenyl)silane has a molecular weight of 484.74 g/mol, XLogP of 3.48, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(diphenyl)silane;triethoxy(phenyl)silane is sourced from PubChem (CID 174286071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).