About boric acid;triethoxy(phenyl)silane
boric acid;triethoxy(phenyl)silane (PubChem CID 174800585) has the molecular formula C12H23BO6Si
and a molecular weight of 302.21 g/mol. Its IUPAC name is boric acid;triethoxy(phenyl)silane.
Molecular Properties
| Compound Name | boric acid;triethoxy(phenyl)silane |
| PubChem CID | 174800585 |
| Molecular Formula | C12H23BO6Si |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | boric acid;triethoxy(phenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1.OB(O)O |
| InChI | InChI=1S/C12H20O3Si.BH3O3/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;2-1(3)4/h7-11H,4-6H2,1-3H3;2-4H |
| InChIKey | HTALHOJYMXUVJI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;triethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;triethoxy(phenyl)silane?
The IUPAC name of boric acid;triethoxy(phenyl)silane (CID 174800585) is boric acid;triethoxy(phenyl)silane.
What is the SMILES notation for boric acid;triethoxy(phenyl)silane?
The canonical SMILES for boric acid;triethoxy(phenyl)silane is CCO[Si](OCC)(OCC)c1ccccc1.OB(O)O.
What is the InChIKey of boric acid;triethoxy(phenyl)silane?
The InChIKey is HTALHOJYMXUVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3Si.BH3O3/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;2-1(3)4/h7-11H,4-6H2,1-3H3;2-4H.
What are the key properties of boric acid;triethoxy(phenyl)silane?
boric acid;triethoxy(phenyl)silane has a molecular weight of 302.21 g/mol, XLogP of -0.11, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;triethoxy(phenyl)silane is sourced from PubChem (CID 174800585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).