About ethane;triethoxy(phenyl)silane
ethane;triethoxy(phenyl)silane (PubChem CID 174836592) has the molecular formula C14H26O3Si
and a molecular weight of 270.44 g/mol. Its IUPAC name is ethane;triethoxy(phenyl)silane.
Molecular Properties
| Compound Name | ethane;triethoxy(phenyl)silane |
| PubChem CID | 174836592 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | ethane;triethoxy(phenyl)silane |
| SMILES | CC.CCO[Si](OCC)(OCC)c1ccccc1 |
| InChI | InChI=1S/C12H20O3Si.C2H6/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;1-2/h7-11H,4-6H2,1-3H3;1-2H3 |
| InChIKey | QSURSRNRRUGINE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;triethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;triethoxy(phenyl)silane?
The IUPAC name of ethane;triethoxy(phenyl)silane (CID 174836592) is ethane;triethoxy(phenyl)silane.
What is the SMILES notation for ethane;triethoxy(phenyl)silane?
The canonical SMILES for ethane;triethoxy(phenyl)silane is CC.CCO[Si](OCC)(OCC)c1ccccc1.
What is the InChIKey of ethane;triethoxy(phenyl)silane?
The InChIKey is QSURSRNRRUGINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3Si.C2H6/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12;1-2/h7-11H,4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;triethoxy(phenyl)silane?
ethane;triethoxy(phenyl)silane has a molecular weight of 270.44 g/mol, XLogP of 2.97, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;triethoxy(phenyl)silane is sourced from PubChem (CID 174836592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).