C12H15F5O3Si — CID 53432346
diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane (PubChem CID 53432346) has the molecular formula C12H15F5O3Si and a molecular weight of 330.33 g/mol. Its IUPAC name is diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane.
| Compound Name | diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane |
|---|---|
| PubChem CID | 53432346 |
| Molecular Formula | C12H15F5O3Si |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane |
| SMILES | CCO[Si](OCC)(OC(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C12H15F5O3Si/c1-3-18-21(19-4-2,10-8-6-5-7-9-10)20-12(16,17)11(13,14)15/h5-9H,3-4H2,1-2H3 |
| InChIKey | WKHHNUXTTZQGDL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|