C24H15F25O6Si2 — CID 158411675
diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane;tris(1,1,2,2,2-pentafluoroethoxy)-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 158411675) has the molecular formula C24H15F25O6Si2 and a molecular weight of 930.50 g/mol. Its IUPAC name is diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane;tris(1,1,2,2,2-pentafluoroethoxy)-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane;tris(1,1,2,2,2-pentafluoroethoxy)-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 158411675 |
| Molecular Formula | C24H15F25O6Si2 |
| Molecular Weight | 930.50 g/mol |
| Exact Mass | 930.00 |
| IUPAC Name | diethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenylsilane;tris(1,1,2,2,2-pentafluoroethoxy)-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CCO[Si](OCC)(OC(F)(F)C(F)(F)F)c1ccccc1.Fc1c(F)c(F)c([Si](OC(F)(F)C(F)(F)F)(OC(F)(F)C(F)(F)F)OC(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C12F20O3Si.C12H15F5O3Si/c13-1-2(14)4(16)6(5(17)3(1)15)36(33-10(27,28)7(18,19)20,34-11(29,30)8(21,22)23)35-12(31,32)9(24,25)26;1-3-18-21(19-4-2,10-8-6-5-7-9-10)20-12(16,17)11(13,14)15/h;5-9H,3-4H2,1-2H3 |
| InChIKey | GZJUYINQUHACOU-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.50 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|