C13H15F5O2Si — CID 87972561
ethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenyl-prop-2-enylsilane (PubChem CID 87972561) has the molecular formula C13H15F5O2Si and a molecular weight of 326.34 g/mol. Its IUPAC name is ethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenyl-prop-2-enylsilane.
| Compound Name | ethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 87972561 |
| Molecular Formula | C13H15F5O2Si |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | ethoxy-(1,1,2,2,2-pentafluoroethoxy)-phenyl-prop-2-enylsilane |
| SMILES | C=CC[Si](OCC)(OC(F)(F)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H15F5O2Si/c1-3-10-21(19-4-2,11-8-6-5-7-9-11)20-13(17,18)12(14,15)16/h3,5-9H,1,4,10H2,2H3 |
| InChIKey | IKRJMJHEOYAQNV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|