C13H15F5O2Si — CID 22389964
diethoxy-(2,3,4,5,6-pentafluorophenyl)-prop-2-enylsilane (PubChem CID 22389964) has the molecular formula C13H15F5O2Si and a molecular weight of 326.34 g/mol. Its IUPAC name is diethoxy-(2,3,4,5,6-pentafluorophenyl)-prop-2-enylsilane.
| Compound Name | diethoxy-(2,3,4,5,6-pentafluorophenyl)-prop-2-enylsilane |
|---|---|
| PubChem CID | 22389964 |
| Molecular Formula | C13H15F5O2Si |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | diethoxy-(2,3,4,5,6-pentafluorophenyl)-prop-2-enylsilane |
| SMILES | C=CC[Si](OCC)(OCC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H15F5O2Si/c1-4-7-21(19-5-2,20-6-3)13-11(17)9(15)8(14)10(16)12(13)18/h4H,1,5-7H2,2-3H3 |
| InChIKey | OJBQXDIXORCQNO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|